| Nama produk |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl klorida |
| Sinonim |
; trans-5-Norbornene-2,3-dicarbonyl klorida; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| Nama Inggeris |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride; trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| MF |
C9H8Cl2O2 |
| Berat Molekul |
219.0646 |
| InChI |
InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
| CAS NO |
4582-21-2 |
| EINECS |
224-967-5 |
| Struktur Molekul |
|
| Kepadatan |
1.453g/cm3 |
| Titik didih |
243.334°C at 760 mmHg |
| Indeks bias |
1.56 |
| Titik nyala |
133.454°C |
| Tekanan wap |
0.032mmHg at 25°C |
| Cinta bahaya |
C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|